Products 114226-44-7

CAS 114226-44-7 is the registry number for Phenindamine Nitrate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-methyl-9-phenyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine;nitric acid (CAS 114226-44-7) is a chemical compound with the molecular formula C19H20N2O3 and a molecular weight of 324.4 g/mol. IUPAC name: 2-methyl-9-phenyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine;nitric acid. InChIKey: VNPBUNUBQYZEKS-UHFFFAOYSA-N.

Identity
Molecular formulaC19H20N2O3
Molecular weight324.4 g/mol
IUPAC name2-methyl-9-phenyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine;nitric acid
InChIKeyVNPBUNUBQYZEKS-UHFFFAOYSA-N
SMILESCN1CCC2=C(C1)C(C3=CC=CC=C23)C4=CC=CC=C4.[N+](=O)(O)[O-]

Computed by PubChem (NCBI)