CAS 114226-44-7 is the registry number for Phenindamine Nitrate. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-9-phenyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine;nitric acid (CAS 114226-44-7) is a chemical compound with the molecular formula C19H20N2O3 and a molecular weight of 324.4 g/mol. IUPAC name: 2-methyl-9-phenyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine;nitric acid. InChIKey: VNPBUNUBQYZEKS-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O3 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 2-methyl-9-phenyl-1,3,4,9-tetrahydroindeno[2,1-c]pyridine;nitric acid |
| InChIKey | VNPBUNUBQYZEKS-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1)C(C3=CC=CC=C23)C4=CC=CC=C4.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)