CAS 1881270-48-9 is the registry number for 2-Amino-3-benzoyl-5-chloro-alpha-(propylthio)benzeneacetamide. Offered by: TRC. Available pack sizes: 100mg.
2-(2-amino-3-benzoyl-5-chlorophenyl)-2-propylsulfanylacetamide (CAS 1881270-48-9) is a chemical compound with the molecular formula C18H19ClN2O2S and a molecular weight of 362.9 g/mol. IUPAC name: 2-(2-amino-3-benzoyl-5-chlorophenyl)-2-propylsulfanylacetamide. InChIKey: AFMWIFOCKCYOPV-UHFFFAOYSA-N.
| Molecular formula | C18H19ClN2O2S |
|---|---|
| Molecular weight | 362.9 g/mol |
| IUPAC name | 2-(2-amino-3-benzoyl-5-chlorophenyl)-2-propylsulfanylacetamide |
| InChIKey | AFMWIFOCKCYOPV-UHFFFAOYSA-N |
| SMILES | CCCSC(C1=C(C(=CC(=C1)Cl)C(=O)C2=CC=CC=C2)N)C(=O)N |
Computed by PubChem (NCBI)