CAS 1881275-67-7 is the registry number for (1S,3R,4S)-Rel-4-(boc-amino)-3-fluorocyclohexanol, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
Tert-butyl N-[(1S,2R,4S)-2-fluoro-4-hydroxycyclohexyl]carbamate (CAS 1881275-67-7) is a chemical compound with the molecular formula C11H20FNO3 and a molecular weight of 233.28 g/mol. IUPAC name: tert-butyl N-[(1S,2R,4S)-2-fluoro-4-hydroxycyclohexyl]carbamate. InChIKey: SSJLYZCXMMQWCU-YIZRAAEISA-N.
| Molecular formula | C11H20FNO3 |
|---|---|
| Molecular weight | 233.28 g/mol |
| IUPAC name | tert-butyl N-[(1S,2R,4S)-2-fluoro-4-hydroxycyclohexyl]carbamate |
| InChIKey | SSJLYZCXMMQWCU-YIZRAAEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@@H](C[C@H]1F)O |
Computed by PubChem (NCBI)