CAS 1881275-73-5 is the registry number for (4aS,7aS)-Octahydropyrrolo[3,4-b][1,4]oxazine dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b][1,4]oxazine;dihydrochloride (CAS 1881275-73-5) is a chemical compound with the molecular formula C6H14Cl2N2O and a molecular weight of 201.09 g/mol. IUPAC name: (4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b][1,4]oxazine;dihydrochloride. InChIKey: KXFOELXPYXZMLA-USPAICOZSA-N.
| Molecular formula | C6H14Cl2N2O |
|---|---|
| Molecular weight | 201.09 g/mol |
| IUPAC name | (4aS,7aS)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b][1,4]oxazine;dihydrochloride |
| InChIKey | KXFOELXPYXZMLA-USPAICOZSA-N |
| SMILES | C1CO[C@H]2CNC[C@@H]2N1.Cl.Cl |
Computed by PubChem (NCBI)