CAS 1881275-82-6 is the registry number for (1R,2R,4S)-Rel-7-azabicyclo[2.2.1]heptan-2-ol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg.
(1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride (CAS 1881275-82-6) is a chemical compound with the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. IUPAC name: (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride. InChIKey: YNVTZOIAXSPRQO-FPKZOZHISA-N.
| Molecular formula | C6H12ClNO |
|---|---|
| Molecular weight | 149.62 g/mol |
| IUPAC name | (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride |
| InChIKey | YNVTZOIAXSPRQO-FPKZOZHISA-N |
| SMILES | C1C[C@@H]2[C@@H](C[C@H]1N2)O.Cl |
Computed by PubChem (NCBI)