CAS 1881289-09-3 is the registry number for 5-chloro-2-[(4-methylpiperazin-1-yl)methyl]phenol dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-chloro-2-[(4-methylpiperazin-1-yl)methyl]phenol;dihydrochloride (CAS 1881289-09-3) is a chemical compound with the molecular formula C12H19Cl3N2O and a molecular weight of 313.6 g/mol. IUPAC name: 5-chloro-2-[(4-methylpiperazin-1-yl)methyl]phenol;dihydrochloride. InChIKey: BMIRRZXVEOKFGK-UHFFFAOYSA-N.
| Molecular formula | C12H19Cl3N2O |
|---|---|
| Molecular weight | 313.6 g/mol |
| IUPAC name | 5-chloro-2-[(4-methylpiperazin-1-yl)methyl]phenol;dihydrochloride |
| InChIKey | BMIRRZXVEOKFGK-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=C(C=C(C=C2)Cl)O.Cl.Cl |
Computed by PubChem (NCBI)