CAS 1881289-39-9 is the registry number for 1-butoxy-2,3-dichloro-4-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-butoxy-2,3-dichloro-4-nitrobenzene (CAS 1881289-39-9) is a chemical compound with the molecular formula C10H11Cl2NO3 and a molecular weight of 264.10 g/mol. IUPAC name: 1-butoxy-2,3-dichloro-4-nitrobenzene. InChIKey: OSDRXCPXVVNTGC-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO3 |
|---|---|
| Molecular weight | 264.10 g/mol |
| IUPAC name | 1-butoxy-2,3-dichloro-4-nitrobenzene |
| InChIKey | OSDRXCPXVVNTGC-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C(C(=C(C=C1)[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)