Products 2918773-59-6
CAS 2918773-59-6 is the registry number for Methyl (R)-2-((3,5-dichloropyridin-2-yl)oxy)butanoate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]butanoate (CAS 2918773-59-6) is a chemical compound with the molecular formula C10H11Cl2NO3 and a molecular weight of 264.10 g/mol. IUPAC name: methyl (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]butanoate. InChIKey: PIUBKMFFAHWMBP-MRVPVSSYSA-N.
| Molecular formula | C10H11Cl2NO3 |
|---|---|
| Molecular weight | 264.10 g/mol |
| IUPAC name | methyl (2R)-2-[(3,5-dichloro-2-pyridinyl)oxy]butanoate |
| InChIKey | PIUBKMFFAHWMBP-MRVPVSSYSA-N |
| SMILES | CC[C@H](C(=O)OC)OC1=C(C=C(C=N1)Cl)Cl |
Computed by PubChem (NCBI)