CAS 1881289-55-9 is the registry number for 4-[(tert-butyldimethylsilyl)oxy]-2,3-difluorophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-[tert-butyl(dimethyl)silyl]oxy-2,3-difluorophenol (CAS 1881289-55-9) is a chemical compound with the molecular formula C12H18F2O2Si and a molecular weight of 260.35 g/mol. IUPAC name: 4-[tert-butyl(dimethyl)silyl]oxy-2,3-difluorophenol. InChIKey: SFFNWPATVNCMJL-UHFFFAOYSA-N.
| Molecular formula | C12H18F2O2Si |
|---|---|
| Molecular weight | 260.35 g/mol |
| IUPAC name | 4-[tert-butyl(dimethyl)silyl]oxy-2,3-difluorophenol |
| InChIKey | SFFNWPATVNCMJL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C(C(=C(C=C1)O)F)F |
Computed by PubChem (NCBI)