CAS 1881290-94-3 appears in our catalog under these names: 4-(4-BOC-Piperazino)methyl-2-bromo-1-chlorobenzene, 95%, tert-Butyl 4-(3-bromo-4-chlorobenzyl)piperazine-1-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
Tert-butyl 4-[(3-bromo-4-chlorophenyl)methyl]piperazine-1-carboxylate (CAS 1881290-94-3) is a chemical compound with the molecular formula C16H22BrClN2O2 and a molecular weight of 389.7 g/mol. IUPAC name: tert-butyl 4-[(3-bromo-4-chlorophenyl)methyl]piperazine-1-carboxylate. InChIKey: LRECVIRSBBGIAU-UHFFFAOYSA-N.
| Molecular formula | C16H22BrClN2O2 |
|---|---|
| Molecular weight | 389.7 g/mol |
| IUPAC name | tert-butyl 4-[(3-bromo-4-chlorophenyl)methyl]piperazine-1-carboxylate |
| InChIKey | LRECVIRSBBGIAU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CC2=CC(=C(C=C2)Cl)Br |
Computed by PubChem (NCBI)