Products 1881291-20-8
CAS 1881291-20-8 is the registry number for tert-butyl N-(3,4-dichlorophenyl)-N-propylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl N-(3,4-dichlorophenyl)-N-propylcarbamate (CAS 1881291-20-8) is a chemical compound with the molecular formula C14H19Cl2NO2 and a molecular weight of 304.2 g/mol. IUPAC name: tert-butyl N-(3,4-dichlorophenyl)-N-propylcarbamate. InChIKey: KCQKMDKIQOBBHN-UHFFFAOYSA-N.
| Molecular formula | C14H19Cl2NO2 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | tert-butyl N-(3,4-dichlorophenyl)-N-propylcarbamate |
| InChIKey | KCQKMDKIQOBBHN-UHFFFAOYSA-N |
| SMILES | CCCN(C1=CC(=C(C=C1)Cl)Cl)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)