CAS 178481-89-5 appears in our catalog under these names: 4-(2-(Bis(2-chloroethyl)amino)phenyl)butanoic acid, 98%, Chlorambucil EP Impurity G (ortho Chlorambucil), Chlorambucil Impurity 9, ortho-Chlorambucil. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[2-[bis(2-chloroethyl)amino]phenyl]butanoic acid (CAS 178481-89-5) is a chemical compound with the molecular formula C14H19Cl2NO2 and a molecular weight of 304.2 g/mol. IUPAC name: 4-[2-[bis(2-chloroethyl)amino]phenyl]butanoic acid. InChIKey: JLERWRRRDFUKIT-UHFFFAOYSA-N.
| Molecular formula | C14H19Cl2NO2 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | 4-[2-[bis(2-chloroethyl)amino]phenyl]butanoic acid |
| InChIKey | JLERWRRRDFUKIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCCC(=O)O)N(CCCl)CCCl |
Computed by PubChem (NCBI)