CAS 1881293-27-1 is the registry number for 4-{2-[(tert-butyldimethylsilyl)oxy]ethyl}-3-fluorophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluorophenol (CAS 1881293-27-1) is a chemical compound with the molecular formula C14H23FO2Si and a molecular weight of 270.41 g/mol. IUPAC name: 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluorophenol. InChIKey: GUWZQAUTHFFBCQ-UHFFFAOYSA-N.
| Molecular formula | C14H23FO2Si |
|---|---|
| Molecular weight | 270.41 g/mol |
| IUPAC name | 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluorophenol |
| InChIKey | GUWZQAUTHFFBCQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1=C(C=C(C=C1)O)F |
Computed by PubChem (NCBI)