Products 1881293-75-9
CAS 1881293-75-9 is the registry number for 3-chloro-5-fluoro-N-propylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-chloro-5-fluoro-N-propylbenzamide (CAS 1881293-75-9) is a chemical compound with the molecular formula C10H11ClFNO and a molecular weight of 215.65 g/mol. IUPAC name: 3-chloro-5-fluoro-N-propylbenzamide. InChIKey: FJIZNTKZNTVRRQ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClFNO |
|---|---|
| Molecular weight | 215.65 g/mol |
| IUPAC name | 3-chloro-5-fluoro-N-propylbenzamide |
| InChIKey | FJIZNTKZNTVRRQ-UHFFFAOYSA-N |
| SMILES | CCCNC(=O)C1=CC(=CC(=C1)Cl)F |
Computed by PubChem (NCBI)