CAS 1017026-21-9 appears in our catalog under these names: 2-Chloro-n-(5-fluoro-2-methylphenyl)propanamide, 95%, N-(5-Fluoro-2-methylphenyl)-2-chloropropanamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 5000mg.
2-chloro-N-(5-fluoro-2-methylphenyl)propanamide (CAS 1017026-21-9) is a chemical compound with the molecular formula C10H11ClFNO and a molecular weight of 215.65 g/mol. IUPAC name: 2-chloro-N-(5-fluoro-2-methylphenyl)propanamide. InChIKey: XXWUMDXEVMLIPX-UHFFFAOYSA-N.
| Molecular formula | C10H11ClFNO |
|---|---|
| Molecular weight | 215.65 g/mol |
| IUPAC name | 2-chloro-N-(5-fluoro-2-methylphenyl)propanamide |
| InChIKey | XXWUMDXEVMLIPX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)F)NC(=O)C(C)Cl |
Computed by PubChem (NCBI)