CAS 1881295-23-3 is the registry number for 1-chloro-3-(cyclopentyloxy)-2,4-difluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-chloro-3-cyclopentyloxy-2,4-difluorobenzene (CAS 1881295-23-3) is a chemical compound with the molecular formula C11H11ClF2O and a molecular weight of 232.65 g/mol. IUPAC name: 1-chloro-3-cyclopentyloxy-2,4-difluorobenzene. InChIKey: POVDYZDSIAORIZ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClF2O |
|---|---|
| Molecular weight | 232.65 g/mol |
| IUPAC name | 1-chloro-3-cyclopentyloxy-2,4-difluorobenzene |
| InChIKey | POVDYZDSIAORIZ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=C(C=CC(=C2F)Cl)F |
Computed by PubChem (NCBI)