CAS 1881295-43-7 is the registry number for 5-hydroxy-N,N-dimethyl-1H-pyrazole-1-sulfonamide, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N,N-dimethyl-3-oxo-1H-pyrazole-2-sulfonamide (CAS 1881295-43-7) is a chemical compound with the molecular formula C5H9N3O3S and a molecular weight of 191.21 g/mol. IUPAC name: N,N-dimethyl-3-oxo-1H-pyrazole-2-sulfonamide. InChIKey: GFPFIDVGHFKBLR-UHFFFAOYSA-N.
| Molecular formula | C5H9N3O3S |
|---|---|
| Molecular weight | 191.21 g/mol |
| IUPAC name | N,N-dimethyl-3-oxo-1H-pyrazole-2-sulfonamide |
| InChIKey | GFPFIDVGHFKBLR-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1C(=O)C=CN1 |
Computed by PubChem (NCBI)