CAS 1881295-48-2 is the registry number for tert-butyl 5-[(tert-butyldimethylsilyl)oxy]-2-hydroxy-1H-indole-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyindole-1-carboxylate (CAS 1881295-48-2) is a chemical compound with the molecular formula C19H29NO4Si and a molecular weight of 363.5 g/mol. IUPAC name: tert-butyl 5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyindole-1-carboxylate. InChIKey: XTBWVPUVMUAFLO-UHFFFAOYSA-N.
| Molecular formula | C19H29NO4Si |
|---|---|
| Molecular weight | 363.5 g/mol |
| IUPAC name | tert-butyl 5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyindole-1-carboxylate |
| InChIKey | XTBWVPUVMUAFLO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=C(C=C2)O[Si](C)(C)C(C)(C)C)C=C1O |
Computed by PubChem (NCBI)