CAS 1881296-40-7 is the registry number for 2-methyl-5-nitropyridine hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-methyl-5-nitropyridine;hydrate (CAS 1881296-40-7) is a chemical compound with the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. IUPAC name: 2-methyl-5-nitropyridine;hydrate. InChIKey: XFARIRKGAKAZPI-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O3 |
|---|---|
| Molecular weight | 156.14 g/mol |
| IUPAC name | 2-methyl-5-nitropyridine;hydrate |
| InChIKey | XFARIRKGAKAZPI-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)[N+](=O)[O-].O |
Computed by PubChem (NCBI)