CAS 1881321-01-2 appears in our catalog under these names: 1-Ethoxy-2-fluoro-3-nitrobenzene, 96%, 1-Ethoxy-2-fluoro-3-nitrobenzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-ethoxy-2-fluoro-3-nitrobenzene (CAS 1881321-01-2) is a chemical compound with the molecular formula C8H8FNO3 and a molecular weight of 185.15 g/mol. IUPAC name: 1-ethoxy-2-fluoro-3-nitrobenzene. InChIKey: WZJVAUJPHRCEFC-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO3 |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 1-ethoxy-2-fluoro-3-nitrobenzene |
| InChIKey | WZJVAUJPHRCEFC-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC(=C1F)[N+](=O)[O-] |
Computed by PubChem (NCBI)