Products 1881321-28-3
CAS 1881321-28-3 is the registry number for 6-butoxy-2-fluoro-3-nitropyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-butoxy-2-fluoro-3-nitropyridine (CAS 1881321-28-3) is a chemical compound with the molecular formula C9H11FN2O3 and a molecular weight of 214.19 g/mol. IUPAC name: 6-butoxy-2-fluoro-3-nitropyridine. InChIKey: POXKZFWKJIFWFH-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O3 |
|---|---|
| Molecular weight | 214.19 g/mol |
| IUPAC name | 6-butoxy-2-fluoro-3-nitropyridine |
| InChIKey | POXKZFWKJIFWFH-UHFFFAOYSA-N |
| SMILES | CCCCOC1=NC(=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)