CAS 1314393-22-0 is the registry number for 2-Amino-3-fluoro-4,5-dimethoxybenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 500mg.
2-amino-3-fluoro-4,5-dimethoxybenzamide (CAS 1314393-22-0) is a chemical compound with the molecular formula C9H11FN2O3 and a molecular weight of 214.19 g/mol. IUPAC name: 2-amino-3-fluoro-4,5-dimethoxybenzamide. InChIKey: NKFOONRRXFWWGL-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O3 |
|---|---|
| Molecular weight | 214.19 g/mol |
| IUPAC name | 2-amino-3-fluoro-4,5-dimethoxybenzamide |
| InChIKey | NKFOONRRXFWWGL-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C(=O)N)N)F)OC |
Computed by PubChem (NCBI)