CAS 1881321-45-4 is the registry number for 3-chloro-4,5-bis(propan-2-yloxy)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-chloro-4,5-di(propan-2-yloxy)phenol (CAS 1881321-45-4) is a chemical compound with the molecular formula C12H17ClO3 and a molecular weight of 244.71 g/mol. IUPAC name: 3-chloro-4,5-di(propan-2-yloxy)phenol. InChIKey: VELKVCRFNVNLBE-UHFFFAOYSA-N.
| Molecular formula | C12H17ClO3 |
|---|---|
| Molecular weight | 244.71 g/mol |
| IUPAC name | 3-chloro-4,5-di(propan-2-yloxy)phenol |
| InChIKey | VELKVCRFNVNLBE-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=CC(=C1)O)Cl)OC(C)C |
Computed by PubChem (NCBI)