Products 1881322-08-2
CAS 1881322-08-2 is the registry number for 2-fluoro-5-hydroxy-N-phenylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-fluoro-5-hydroxy-N-phenylbenzamide (CAS 1881322-08-2) is a chemical compound with the molecular formula C13H10FNO2 and a molecular weight of 231.22 g/mol. IUPAC name: 2-fluoro-5-hydroxy-N-phenylbenzamide. InChIKey: ZGZKJJABDLNQMR-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO2 |
|---|---|
| Molecular weight | 231.22 g/mol |
| IUPAC name | 2-fluoro-5-hydroxy-N-phenylbenzamide |
| InChIKey | ZGZKJJABDLNQMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=C(C=CC(=C2)O)F |
Computed by PubChem (NCBI)