CAS 582325-06-2 appears in our catalog under these names: 6-(4-Fluorophenyl)-2-methylnicotinic acid, 97%, 6-(4-Fluorophenyl)-2-methylpyridine-3-carboxylic acid, 6-(4-Fluorophenyl)-2-methylpyridine-3-carboxylic acid, 95%. Offered by: AmBeed, Biosynth, Combi-blocks. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg.
6-(4-fluorophenyl)-2-methylpyridine-3-carboxylic acid (CAS 582325-06-2) is a chemical compound with the molecular formula C13H10FNO2 and a molecular weight of 231.22 g/mol. IUPAC name: 6-(4-fluorophenyl)-2-methylpyridine-3-carboxylic acid. InChIKey: XEJOXNREXHRKEN-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO2 |
|---|---|
| Molecular weight | 231.22 g/mol |
| IUPAC name | 6-(4-fluorophenyl)-2-methylpyridine-3-carboxylic acid |
| InChIKey | XEJOXNREXHRKEN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)