CAS 1881328-08-0 is the registry number for tert-butyl(3,6-dichloro-2-fluorophenoxy)dimethylsilane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl-(3,6-dichloro-2-fluorophenoxy)-dimethylsilane (CAS 1881328-08-0) is a chemical compound with the molecular formula C12H17Cl2FOSi and a molecular weight of 295.25 g/mol. IUPAC name: tert-butyl-(3,6-dichloro-2-fluorophenoxy)-dimethylsilane. InChIKey: DHYNCFORYDEKBP-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2FOSi |
|---|---|
| Molecular weight | 295.25 g/mol |
| IUPAC name | tert-butyl-(3,6-dichloro-2-fluorophenoxy)-dimethylsilane |
| InChIKey | DHYNCFORYDEKBP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C(C=CC(=C1F)Cl)Cl |
Computed by PubChem (NCBI)