CAS 1881328-68-2 appears in our catalog under these names: 2,3-Diaminobenzonitrile hydrochloride, 96%, 2,3-Diaminobenzonitrile hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2,5g.
2,3-diaminobenzonitrile;hydrochloride (CAS 1881328-68-2) is a chemical compound with the molecular formula C7H8ClN3 and a molecular weight of 169.61 g/mol. IUPAC name: 2,3-diaminobenzonitrile;hydrochloride. InChIKey: IZFGJGQBGKICHW-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3 |
|---|---|
| Molecular weight | 169.61 g/mol |
| IUPAC name | 2,3-diaminobenzonitrile;hydrochloride |
| InChIKey | IZFGJGQBGKICHW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)N)C#N.Cl |
Computed by PubChem (NCBI)