CAS 1881328-74-0 appears in our catalog under these names: 5-nitro-1H-pyrazole hydrochloride, 95%, 3-nitro-1H-pyrazole hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-nitro-1H-pyrazole;hydrochloride (CAS 1881328-74-0) is a chemical compound with the molecular formula C3H4ClN3O2 and a molecular weight of 149.53 g/mol. IUPAC name: 5-nitro-1H-pyrazole;hydrochloride. InChIKey: LXTQIRPEYXLAMI-UHFFFAOYSA-N.
| Molecular formula | C3H4ClN3O2 |
|---|---|
| Molecular weight | 149.53 g/mol |
| IUPAC name | 5-nitro-1H-pyrazole;hydrochloride |
| InChIKey | LXTQIRPEYXLAMI-UHFFFAOYSA-N |
| SMILES | C1=C(NN=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)