CAS 1881331-54-9 is the registry number for 2,6-difluoro-3-nitropyridine hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,6-difluoro-3-nitropyridine;hydrate (CAS 1881331-54-9) is a chemical compound with the molecular formula C5H4F2N2O3 and a molecular weight of 178.09 g/mol. IUPAC name: 2,6-difluoro-3-nitropyridine;hydrate. InChIKey: HVZLKMKSDMBFTP-UHFFFAOYSA-N.
| Molecular formula | C5H4F2N2O3 |
|---|---|
| Molecular weight | 178.09 g/mol |
| IUPAC name | 2,6-difluoro-3-nitropyridine;hydrate |
| InChIKey | HVZLKMKSDMBFTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1[N+](=O)[O-])F)F.O |
Computed by PubChem (NCBI)