Products 1881428-85-8

CAS 1881428-85-8 is the registry number for 5-Ethynylfuran-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-ethynylfuran-3-carboxylic acid (CAS 1881428-85-8) is a chemical compound with the molecular formula C7H4O3 and a molecular weight of 136.10 g/mol. IUPAC name: 5-ethynylfuran-3-carboxylic acid. InChIKey: CTUZDRWDKHVVEL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4O3
Molecular weight136.10 g/mol
IUPAC name5-ethynylfuran-3-carboxylic acid
InChIKeyCTUZDRWDKHVVEL-UHFFFAOYSA-N
SMILESC#CC1=CC(=CO1)C(=O)O

Computed by PubChem (NCBI)