CAS 18819-89-1 appears in our catalog under these names: Tetrabutylammonium benzoate, 98%, Tetrabutylammonium benzoate, 95-<97%, Tetrabutylammonium benzoate, ≥97-<99%, Tetrabutylammonium benzoate, Tetrabutylammonium benzoate. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Biosynth, Ambeed. Available pack sizes: 5g, 1g, 25g, 10g, 50g, 100g, 200g, 300g.
Tetrabutylazanium benzoate (CAS 18819-89-1) is a chemical compound with the molecular formula C23H41NO2 and a molecular weight of 363.6 g/mol. IUPAC name: tetrabutylazanium benzoate. InChIKey: WGYONVRJGWHMKV-UHFFFAOYSA-M.
| Molecular formula | C23H41NO2 |
|---|---|
| Molecular weight | 363.6 g/mol |
| IUPAC name | tetrabutylazanium benzoate |
| InChIKey | WGYONVRJGWHMKV-UHFFFAOYSA-M |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.C1=CC=C(C=C1)C(=O)[O-] |
Computed by PubChem (NCBI)