CAS 1883264-36-5 appears in our catalog under these names: 2–Cyanobutan–2–yl 3,5–dimethyl–1H–pyrazole–1–carbodithioate, 2-cyanobutanyl-2-yl 3,5-dimethyl-1H-pyrazole-1-carbodithioate, 95.0%, 95.0%. Offered by: GLPBio, Chemat. Available pack sizes: 5g, 250mg, 1g.
2-cyanobutan-2-yl 3,5-dimethylpyrazole-1-carbodithioate (CAS 1883264-36-5) is a chemical compound with the molecular formula C11H15N3S2 and a molecular weight of 253.4 g/mol. IUPAC name: 2-cyanobutan-2-yl 3,5-dimethylpyrazole-1-carbodithioate. InChIKey: YLQFEMAFHJDHDH-UHFFFAOYSA-N.
| Molecular formula | C11H15N3S2 |
|---|---|
| Molecular weight | 253.4 g/mol |
| IUPAC name | 2-cyanobutan-2-yl 3,5-dimethylpyrazole-1-carbodithioate |
| InChIKey | YLQFEMAFHJDHDH-UHFFFAOYSA-N |
| SMILES | CCC(C)(C#N)SC(=S)N1C(=CC(=N1)C)C |
Computed by PubChem (NCBI)