CAS 1883545-60-5 appears in our catalog under these names: CRT 0066101, Crt0066101 dihydrochloride, 95%, CRT0066101 dihydrochloride/ 99.85% (existing batch purity), CRT-0066101 hydrochloride, CRT0066101 2HCl 98+%. Offered by: GLPBio, Combi-blocks, TargetMol, Biosynth, Ambeed. Available pack sizes: 5mg, 100mg, 10mg, 1mg, 25mg, 50mg, 0,5g, 250mg.
2-[4-[[(2R)-2-aminobutyl]amino]pyrimidin-2-yl]-4-(1-methylpyrazol-4-yl)phenol;dihydrochloride (CAS 1883545-60-5) is a chemical compound with the molecular formula C18H24Cl2N6O and a molecular weight of 411.3 g/mol. IUPAC name: 2-[4-[[(2R)-2-aminobutyl]amino]pyrimidin-2-yl]-4-(1-methylpyrazol-4-yl)phenol;dihydrochloride. InChIKey: CXYCRYGNFKDPRH-FMOMHUKBSA-N.
| Molecular formula | C18H24Cl2N6O |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | 2-[4-[[(2R)-2-aminobutyl]amino]pyrimidin-2-yl]-4-(1-methylpyrazol-4-yl)phenol;dihydrochloride |
| InChIKey | CXYCRYGNFKDPRH-FMOMHUKBSA-N |
| SMILES | CC[C@H](CNC1=NC(=NC=C1)C2=C(C=CC(=C2)C3=CN(N=C3)C)O)N.Cl.Cl |
Computed by PubChem (NCBI)