CAS 188359-23-1 appears in our catalog under these names: (2S,3S)-2-Amino-2,3-dimethylpentanoic acid, 97%, 2-Methyl-L-isoleucine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
(2S,3S)-2-amino-2,3-dimethylpentanoic acid (CAS 188359-23-1) is a chemical compound with the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. IUPAC name: (2S,3S)-2-amino-2,3-dimethylpentanoic acid. InChIKey: RSPOGBIHKNKRFJ-FSPLSTOPSA-N.
| Molecular formula | C7H15NO2 |
|---|---|
| Molecular weight | 145.20 g/mol |
| IUPAC name | (2S,3S)-2-amino-2,3-dimethylpentanoic acid |
| InChIKey | RSPOGBIHKNKRFJ-FSPLSTOPSA-N |
| SMILES | CC[C@H](C)[C@@](C)(C(=O)O)N |
Computed by PubChem (NCBI)