CAS 1883711-97-4 appears in our catalog under these names: AM 0902, AM-0902/ 100%, AM–0902, AM-0902 98%, AM-0902, 98%, 98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 1mg, 2,5mg, 5mg, 2mg, 10mg, 25mg, 50mg, 100mg.
1-[[3-[2-(4-chlorophenyl)ethyl]-1,2,4-oxadiazol-5-yl]methyl]-7-methylpurin-6-one (CAS 1883711-97-4) is a chemical compound with the molecular formula C17H15ClN6O2 and a molecular weight of 370.8 g/mol. IUPAC name: 1-[[3-[2-(4-chlorophenyl)ethyl]-1,2,4-oxadiazol-5-yl]methyl]-7-methylpurin-6-one. InChIKey: AWJBWNUUODWOKQ-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN6O2 |
|---|---|
| Molecular weight | 370.8 g/mol |
| IUPAC name | 1-[[3-[2-(4-chlorophenyl)ethyl]-1,2,4-oxadiazol-5-yl]methyl]-7-methylpurin-6-one |
| InChIKey | AWJBWNUUODWOKQ-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C(=O)N(C=N2)CC3=NC(=NO3)CCC4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)