Products 1883721-73-0
CAS 1883721-73-0 is the registry number for SF-3-030. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1,1-dioxo-2,3-dihydrothiophen-3-yl) naphthalene-2-sulfonate (CAS 1883721-73-0) is a chemical compound with the molecular formula C14H12O5S2 and a molecular weight of 324.4 g/mol. IUPAC name: (1,1-dioxo-2,3-dihydrothiophen-3-yl) naphthalene-2-sulfonate. InChIKey: UPNQDWDUYZHCMB-UHFFFAOYSA-N.
| Molecular formula | C14H12O5S2 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (1,1-dioxo-2,3-dihydrothiophen-3-yl) naphthalene-2-sulfonate |
| InChIKey | UPNQDWDUYZHCMB-UHFFFAOYSA-N |
| SMILES | C1C(C=CS1(=O)=O)OS(=O)(=O)C2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)