CAS 1883753-49-8 is the registry number for 6-(4-Chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(4-chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octane (CAS 1883753-49-8) is a chemical compound with the molecular formula C12H12ClF2NO and a molecular weight of 259.68 g/mol. IUPAC name: 6-(4-chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octane. InChIKey: ZUVCACAVSADXCC-UHFFFAOYSA-N.
| Molecular formula | C12H12ClF2NO |
|---|---|
| Molecular weight | 259.68 g/mol |
| IUPAC name | 6-(4-chloro-2,6-difluorophenyl)-1-oxa-6-azaspiro[2.5]octane |
| InChIKey | ZUVCACAVSADXCC-UHFFFAOYSA-N |
| SMILES | C1CN(CCC12CO2)C3=C(C=C(C=C3F)Cl)F |
Computed by PubChem (NCBI)