CAS 18838-38-5 appears in our catalog under these names: Creatine Phosphate (potassium salt), Glycine, N-[imino(phosphonoamino)methyl]-N-methyl-, potassium salt (1:2), 98%, 98%, Creatine Phosphate, Dipotass 1PC X 1GM, Creatine Phosphate, Dipotass 1PC X 250MG, Phosphocreatine (dipotassium). Offered by: GLPBio, Chemat, Sigma-Aldrich, MedChemExpress. Available pack sizes: 5mg, 25mg, 100mg, 250mg, 1g, 1GM, 10mg, 50 mg.
Dipotassium;2-[methyl-(N'-phosphonatocarbamimidoyl)amino]acetic acid (CAS 18838-38-5) is a chemical compound with the molecular formula C4H8K2N3O5P and a molecular weight of 287.29 g/mol. IUPAC name: dipotassium;2-[methyl-(N'-phosphonatocarbamimidoyl)amino]acetic acid. InChIKey: SQOKPBMWFCQTDM-UHFFFAOYSA-L.
| Molecular formula | C4H8K2N3O5P |
|---|---|
| Molecular weight | 287.29 g/mol |
| IUPAC name | dipotassium;2-[methyl-(N'-phosphonatocarbamimidoyl)amino]acetic acid |
| InChIKey | SQOKPBMWFCQTDM-UHFFFAOYSA-L |
| SMILES | CN(CC(=O)O)C(=NP(=O)([O-])[O-])N.[K+].[K+] |
Computed by PubChem (NCBI)