CAS 1883816-46-3 appears in our catalog under these names: 6-Bromo-8-iodo-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine, 95%, 6-BRomo-8-iodo-(1,2,4)triazolo(1,5-a)pyridin-2-ylamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
6-bromo-8-iodo-[1,2,4]triazolo[1,5-a]pyridin-2-amine (CAS 1883816-46-3) is a chemical compound with the molecular formula C6H4BrIN4 and a molecular weight of 338.93 g/mol. IUPAC name: 6-bromo-8-iodo-[1,2,4]triazolo[1,5-a]pyridin-2-amine. InChIKey: WOXGXKXJZDECDV-UHFFFAOYSA-N.
| Molecular formula | C6H4BrIN4 |
|---|---|
| Molecular weight | 338.93 g/mol |
| IUPAC name | 6-bromo-8-iodo-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| InChIKey | WOXGXKXJZDECDV-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC(=NN2C=C1Br)N)I |
Computed by PubChem (NCBI)