Products 1884203-25-1
CAS 1884203-25-1 appears in our catalog under these names: 7-(tert-Butyl) 2-ethyl 4-chloro-5,8-dihydro-1,7-naphthyridine-2,7(6h)-dicarboxylate, 95%, 7-tert-Butyl 2-ethyl 4-chloro-5,6-dihydro-1,7-naphthyridine-2,7(8H)-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 5g, 50mg.
7-O-tert-butyl 2-O-ethyl 4-chloro-6,8-dihydro-5H-1,7-naphthyridine-2,7-dicarboxylate (CAS 1884203-25-1) is a chemical compound with the molecular formula C16H21ClN2O4 and a molecular weight of 340.80 g/mol. IUPAC name: 7-O-tert-butyl 2-O-ethyl 4-chloro-6,8-dihydro-5H-1,7-naphthyridine-2,7-dicarboxylate. InChIKey: NOJGRIQPJHZIDV-UHFFFAOYSA-N.
| Molecular formula | C16H21ClN2O4 |
|---|---|
| Molecular weight | 340.80 g/mol |
| IUPAC name | 7-O-tert-butyl 2-O-ethyl 4-chloro-6,8-dihydro-5H-1,7-naphthyridine-2,7-dicarboxylate |
| InChIKey | NOJGRIQPJHZIDV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(CCN(C2)C(=O)OC(C)(C)C)C(=C1)Cl |
Computed by PubChem (NCBI)