Products 2230200-27-6
CAS 2230200-27-6 is the registry number for 1-Boc-4-(6-chloro-2-pyridyl)piperidine-4-carboxylic Acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 1g, 25g.
4-(6-chloro-2-pyridinyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 2230200-27-6) is a chemical compound with the molecular formula C16H21ClN2O4 and a molecular weight of 340.80 g/mol. IUPAC name: 4-(6-chloro-2-pyridinyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: SBCYMHNJXRVZGY-UHFFFAOYSA-N.
| Molecular formula | C16H21ClN2O4 |
|---|---|
| Molecular weight | 340.80 g/mol |
| IUPAC name | 4-(6-chloro-2-pyridinyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | SBCYMHNJXRVZGY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C2=NC(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)