CAS 1884233-77-5 is the registry number for rel-8-(tert-Butyl) 2-methyl (1R,4S,5S)-4-butyl-3-oxo-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-O-tert-butyl 2-O-methyl (1R,4S,5S)-4-butyl-3-oxo-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate (CAS 1884233-77-5) is a chemical compound with the molecular formula C18H29NO5 and a molecular weight of 339.4 g/mol. IUPAC name: 8-O-tert-butyl 2-O-methyl (1R,4S,5S)-4-butyl-3-oxo-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate. InChIKey: XZSDYEWBIZMSDG-ICIURTGMSA-N.
| Molecular formula | C18H29NO5 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 8-O-tert-butyl 2-O-methyl (1R,4S,5S)-4-butyl-3-oxo-8-azabicyclo[3.2.1]octane-2,8-dicarboxylate |
| InChIKey | XZSDYEWBIZMSDG-ICIURTGMSA-N |
| SMILES | CCCC[C@H]1[C@@H]2CC[C@@H](N2C(=O)OC(C)(C)C)C(C1=O)C(=O)OC |
Computed by PubChem (NCBI)