Products 2209841-59-6

CAS 2209841-59-6 is the registry number for 1-(tert-Butyl) 8-ethyl 7-oxo-1-azaspiro[5.5]undecane-1,8-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 10-O-ethyl 11-oxo-1-azaspiro[5.5]undecane-1,10-dicarboxylate (CAS 2209841-59-6) is a chemical compound with the molecular formula C18H29NO5 and a molecular weight of 339.4 g/mol. IUPAC name: 1-O-tert-butyl 10-O-ethyl 11-oxo-1-azaspiro[5.5]undecane-1,10-dicarboxylate. InChIKey: SIOBCCRVMJYCKI-UHFFFAOYSA-N.

Identity
Molecular formulaC18H29NO5
Molecular weight339.4 g/mol
IUPAC name1-O-tert-butyl 10-O-ethyl 11-oxo-1-azaspiro[5.5]undecane-1,10-dicarboxylate
InChIKeySIOBCCRVMJYCKI-UHFFFAOYSA-N
SMILESCCOC(=O)C1CCCC2(C1=O)CCCCN2C(=O)OC(C)(C)C

Computed by PubChem (NCBI)