CAS 1884461-72-6 appears in our catalog under these names: Ensifentrine, 98+%, RPL 554, Ensifentrine, Ensifentrine/ 98.45% (existing batch purity), Ensifentrine 98+%. Offered by: AmBeed, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 250mg, 1mg, 10mM (in 1ml dmso), 50mg, 100mg.
2-[9,10-dimethoxy-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]ethylurea (CAS 1884461-72-6) is a chemical compound with the molecular formula C26H31N5O4 and a molecular weight of 477.6 g/mol. IUPAC name: 2-[9,10-dimethoxy-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]ethylurea. InChIKey: CSOBIBXVIYAXFM-UHFFFAOYSA-N.
| Molecular formula | C26H31N5O4 |
|---|---|
| Molecular weight | 477.6 g/mol |
| IUPAC name | 2-[9,10-dimethoxy-4-oxo-2-(2,4,6-trimethylphenyl)imino-6,7-dihydropyrimido[6,1-a]isoquinolin-3-yl]ethylurea |
| InChIKey | CSOBIBXVIYAXFM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)N=C2C=C3C4=CC(=C(C=C4CCN3C(=O)N2CCNC(=O)N)OC)OC)C |
Computed by PubChem (NCBI)