CAS 1884463-51-7 is the registry number for Efinaconazole Impurity 39. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R)-2-(2,5-difluorophenyl)-3-(oxan-2-yloxy)-1-(1,2,4-triazol-1-yl)butan-2-ol (CAS 1884463-51-7) is a chemical compound with the molecular formula C17H21F2N3O3 and a molecular weight of 353.36 g/mol. IUPAC name: (2R,3R)-2-(2,5-difluorophenyl)-3-(oxan-2-yloxy)-1-(1,2,4-triazol-1-yl)butan-2-ol. InChIKey: BTKBSLSOTARAOZ-SCWIMFDPSA-N.
| Molecular formula | C17H21F2N3O3 |
|---|---|
| Molecular weight | 353.36 g/mol |
| IUPAC name | (2R,3R)-2-(2,5-difluorophenyl)-3-(oxan-2-yloxy)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| InChIKey | BTKBSLSOTARAOZ-SCWIMFDPSA-N |
| SMILES | C[C@H]([C@](CN1C=NC=N1)(C2=C(C=CC(=C2)F)F)O)OC3CCCCO3 |
Computed by PubChem (NCBI)