Products 1884546-29-5

CAS 1884546-29-5 is the registry number for Glutaminyl cyclase inhibitor 2. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.

Structural formula: {0} (CAS {1})

2-(4-fluorophenyl)-N-[3-(4-methylimidazol-1-yl)propyl]aniline (CAS 1884546-29-5) is a chemical compound with the molecular formula C19H20FN3 and a molecular weight of 309.4 g/mol. IUPAC name: 2-(4-fluorophenyl)-N-[3-(4-methylimidazol-1-yl)propyl]aniline. InChIKey: GKLQJZRXGKCXRX-UHFFFAOYSA-N.

Identity
Molecular formulaC19H20FN3
Molecular weight309.4 g/mol
IUPAC name2-(4-fluorophenyl)-N-[3-(4-methylimidazol-1-yl)propyl]aniline
InChIKeyGKLQJZRXGKCXRX-UHFFFAOYSA-N
SMILESCC1=CN(C=N1)CCCNC2=CC=CC=C2C3=CC=C(C=C3)F

Computed by PubChem (NCBI)