CAS 1884571-59-8 is the registry number for SIRT2-IN-14. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[[3-[(4-phenoxybenzoyl)amino]phenyl]methoxy]pyridine-3-carboxamide (CAS 1884571-59-8) is a chemical compound with the molecular formula C26H21N3O4 and a molecular weight of 439.5 g/mol. IUPAC name: 5-[[3-[(4-phenoxybenzoyl)amino]phenyl]methoxy]pyridine-3-carboxamide. InChIKey: ADUUSNQUQWPQDA-UHFFFAOYSA-N.
| Molecular formula | C26H21N3O4 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | 5-[[3-[(4-phenoxybenzoyl)amino]phenyl]methoxy]pyridine-3-carboxamide |
| InChIKey | ADUUSNQUQWPQDA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)NC3=CC=CC(=C3)COC4=CN=CC(=C4)C(=O)N |
Computed by PubChem (NCBI)