Products 1884704-68-0

CAS 1884704-68-0 is the registry number for Piperidin-4-yl n-cyclopropylcarbamate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Piperidin-4-yl N-cyclopropylcarbamate;hydrochloride (CAS 1884704-68-0) is a chemical compound with the molecular formula C9H17ClN2O2 and a molecular weight of 220.69 g/mol. IUPAC name: piperidin-4-yl N-cyclopropylcarbamate;hydrochloride. InChIKey: HDYPIOVQAYGLNM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17ClN2O2
Molecular weight220.69 g/mol
IUPAC namepiperidin-4-yl N-cyclopropylcarbamate;hydrochloride
InChIKeyHDYPIOVQAYGLNM-UHFFFAOYSA-N
SMILESC1CC1NC(=O)OC2CCNCC2.Cl

Computed by PubChem (NCBI)