CAS 1884710-54-6 appears in our catalog under these names: (4-[(Pyrazin-2-yl)carbamoyl]phenyl)boronic acid, 95%, (4–(Pyrazin–2–ylcarbamoyl)phenyl)boronic acid, B-[4-[(2-Pyrazinylamino)Carbonyl]Phenyl]Boronic Acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 250mg, 1g.
[4-(pyrazin-2-ylcarbamoyl)phenyl]boronic acid (CAS 1884710-54-6) is a chemical compound with the molecular formula C11H10BN3O3 and a molecular weight of 243.03 g/mol. IUPAC name: [4-(pyrazin-2-ylcarbamoyl)phenyl]boronic acid. InChIKey: BGQDCAUEKBOHQY-UHFFFAOYSA-N.
| Molecular formula | C11H10BN3O3 |
|---|---|
| Molecular weight | 243.03 g/mol |
| IUPAC name | [4-(pyrazin-2-ylcarbamoyl)phenyl]boronic acid |
| InChIKey | BGQDCAUEKBOHQY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2=NC=CN=C2)(O)O |
Computed by PubChem (NCBI)