CAS 1884715-43-8 appears in our catalog under these names: (4-[(5-Chloropyridin-2-yl)carbamoyl]phenyl)boronic acid, 95%, (4-((5-Chloropyridin-2-yl)carbamoyl)phenyl)boronic acid, 98%, B–(4–(((5–chloro–2–pyridinyl)amino)carbonyl)phenyl)Boronic acid, (4-((5-Chloropyridin-2-yl)carbamoyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg, 50mg.
[4-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]boronic acid (CAS 1884715-43-8) is a chemical compound with the molecular formula C12H10BClN2O3 and a molecular weight of 276.48 g/mol. IUPAC name: [4-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]boronic acid. InChIKey: WXXVRFJTNFNSIF-UHFFFAOYSA-N.
| Molecular formula | C12H10BClN2O3 |
|---|---|
| Molecular weight | 276.48 g/mol |
| IUPAC name | [4-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]boronic acid |
| InChIKey | WXXVRFJTNFNSIF-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2=NC=C(C=C2)Cl)(O)O |
Computed by PubChem (NCBI)